A to Z Exams

Which of the following compounds when heated with CO at 150"C and 500 atm pressure in presence of BF3 forms ethyl propionate ?

A cylinder of gas contains 14.5 kg of butane. If a family needs 2.5x104 KJ of energy per day for cooking. Hoe long will the cylinder last. (Enthalpy of combustion of butane=2600 KJ/mole)

The gas that is used for sterilizing water is

Cuprous ion is colourless while cupric ion is coloured because :

Which of the following reacts with benzene in presence of anhydrous aluminum chloride and forms acetophenone ?

Which of the following pairs of ions are colourless ?

What is the temperature at which the kinetic energy of 0.3 moles of Helium is equal to the kinetic energy of 0.4 moles of Argon at 400 K ?

Observe the following statements regarding purification of bauxiteI. During Hall's process, silica is removed as Si (vapour)II. Bauxite ore contaminated with Fe2O3 is purified in Baeyer's processIII. During Serpeck's process, AlN is formedThe correct answer is

In lime kiln the reaction CaCO3(s)⇔CaO(s)+CO2(g)

'Natalite' is used as

The equilibrium constant Kp for the reaction 2SO2+O2⇔2SO3 is 2.5 atm-1.What would be the partial pressure of O2 at equilibrium. If the equilibrium partial pressures of SO2 and SO3 are equal

Which of the following has the highest first IP

Electrons with a kinetic energy of 6.023 x 104 J/mol are evolved from a surface of a metal, when it is exposed to radiation of wavelength of 600 nm, The minimum amount of energy required to remove an electron from the metal atom is

Which of the following not obtained when methyl chloride and n-propyl chloride react with sodium in dry ether

What is the quantity of electricity (in Coulombs) required to deposit all the silverfrom 250 mL of 1 M AgNO3 solution

The order of pH of 0.200 M solutions of NH4NO3, NaNO3 and Na2CO3 is

For the reaction A(g)⇔B(g)+C(g),Kp at 4000C is 1.5x10-4 and Kp at 6000C is 6x10-3 Then the incorrect statement is

The weakest acid among the following is

The number of π bonds in the product formed by passing acetylene through dil.H2SO4 containing mercuric sulphate is:

How many electrons are present in the M shell of an atom of an clement with atomicnumber 24 (Z = 24) ?

In the reaction AlCl3+Cl-→[AlCl4]-,AlCl3 acts as

The   IUPAC    name    of   the    compound(CH3)2CH-CH=CH-CHOH-CH3 is

The wavelengths of electron waves in two orbits is 3 : 5. The ratio of kinetic energy of electrons will be

The equilibrium constants for the reactions N2(g)+O2(g)⇔2NO(g) and NO(g)+1/2 O2(g) are K1 and K2 respectively .Then the equilibrium constant for the reaction N2(g)+O2(g)⇔2NO2(g) is

Bauxite is a mineral for the extraction of :

The functional groups present in 'salol' are

The number of moles of electrons required to deposit 36 g of Al from an aqueous solution of Al(NO3)3 is (At. wt. of Al = 27)

Method used for the concentration of tinstone ore is

One mole of N2H4 loses 10 moles of electrons to form a new compound Z.Assuming that all the nitrogens appear in the new compound, what is the oxidation state of nitrogen in Z? (There is no change in the oxidation state of hydrogen)

Which of the following is an example of interstitial hydride

The Kc for the reaction A+B↔C is 4 and Kc for 2A+D↔C is 6. The value of Kc for C+D↔2B is

Consider the two gaseous equilibria involving SO2 and the corresponding equilibrium constants at 298K SO2(g)+1/2O2(g)⇔SO3(g);K1 2SO3(g)⇔2SO2(g)+O2(g);K2 The values of the equilibrium constants are related by

A certain current liberated 0.504g of hydrogen in 2hrs. How many grams of copper can be librated by the same current flowing for the same time in a copper sulphate solution

The salt of phosphorous acid are called

The nature of forces operating between the adsorbate and the adsorbent in the adsorption occurring at high temperature is

The rate equation for the reaction A+2B→products is rate=K[A][B]2. If the volume of the vessel is decreased to half of the initial volume the reaction rate bears the following relation to the original rate

A radioactive substance 88X228 (IIA) emits 3α and 3β particles to form "Y". To which group of long form of the periodic table does "Y" belong

Average C-H bond energy is 416 kJ. mol-1. Which of the following is correct ?

A radio isotope has a half life 10 days.If today there is 125g of it left,what was its weight 40 days earlier?

Which of the following elements has least number of electrons in its M shell ?

Given the bond energies of N = N, H — H and N—H bonds as 945, 436 and 391 kj/mol respectively, the enthalpy    of    the    reaction N2(S) + 3H2 (g) —> 2NH3(g) is :

The bonds in K4Fe(CN)6 are:

The concentration of oxalic acid is 'x'mol L-1. 40 mL of this solution reacts with 16 mL of 0.05 M acidified KMn04. What is the pH  of 'x' M oxalic acid solution ? (Assume that oxalic acid dissociates completely)

H3O++OH-→2H2O

Let electronegativity, ionisation energy and electron affinity be represented as EN, IP and EA respectively. Which one of the following equation is correct according to Mulliken?

What is the volume (in litres) of oxygen required at STP to completely convert 1.5 mol of sulpher into sulpher dioxide

Which of the following functional group shows +R effect

Assertion (A) : At 300 K,kinetic energy of 16 g of methane is equal to the kinetic energy of 32 g of oxygen. Reason (R) : At constant temperature,kinetic energy of one mole of all gases is equal. The correct answer is:

A and B are ideal gases. The molecular weights of A and B are in the ratio of 1 : 4. The pressure of a gas mixture containing equal weights of A and B is P atm. What is the partial pressure (in atm) of B in the mixture ?

Bauxite is boiled with aqueous NaOH solution. Sodium meta aluminate solution is formed. This part in the metallurgy of aluminium is called

What is the molecular formula of the product formed when benzene is reacted with ethyl chloride in presence of anhydrous aluminum chloride ?

Which one of the following compounds liberates CO2 from aqueous NaHCO3

Which of the following alkali metals has the greatest tendency for the half reaction;  M(g) →M+(aq) + e

The two sulphur atoms in Na2S2O3 have

Oxide of nitrogen which gives reddish brown colour when exposed to air is

The energy of a photon is 3 x 10-12 ergs.What is its wavelength in nm ?( h = 6.62 x 10 -27ergs-s ; c = 3 x 10 10 cm/s )

1.5 g of CdCl2 was found to contain 0.9 g of Cd. Calculate the Atomic weight of Cd

A sample of 100ml water required 0.294mg of K2Cr2O7(mol.wt=294)for oxidizing dissolved organic compounds in it. The C.O.D of water sample is

Dipole moment of HC1 = 1.03 D, HI = 0.38 D. Bond length of HC1 = 1.3 and HI = 1.6A .The ratio of fraction of an electric charge, δ, existing on each atom in HC1 and HI is

The earthy impurities present in the mineral are called

The cell reaction of a cell is Mg(g)+Cu2+(aq)→Cu(g)+Mg2+(aq).If the standard reduction potentials of magnesium and copper are -0.33 and +2.38V respectively,the e.m.f of the cell is:

If a gas contains only three molecules that move with velocities of 100,200,500 ms-1.What is the rms velocity of that gas in ms-1

The vapour pressure of water at 230C is 19.8 mm. 0.1 mole of glucose is dissolved in 178.2 g of water. What is the vapour pressure (in mm) of the resultant solution

The metal used for the de-bromination reaction of 1, 2 dibromoethane

The molar capacity(Cp)of water at constant pressure is 75 J.K-1.mol-1.The increase in temperature (in K) of 100 g of water when 1 K.J. of heat is supplied to it is

The addition of HCl will not suppress the ionization of

A certain mass of a gas occupies a volume of 2 L at STP. To what temperature the gas must be heated to double its volume, keeping the pressure constant

In Freundlich adsorption isotherm, the intercept is equal to

If ΔE is the heat of reaction for C2H5OH(1)+3O2(g)→2CO2(g)+3H2O(l) at constant volume,the ΔH(Heat of reaction at constant pressure)at constant temperature is

A certain sample of gas has a volume of 0.2 litres measured at 1 atm. pressure and 00 C. At the same pressure but at 273 0c. Its volume will be

Atoms of different elements having identical mass are known as :

The compound prepared by a substitution reaction of benzene is

The value of Kp for the reaction 2H2S(g) ⇔ 2H2(g) + S2(g) is 1.2X10-2 at 10650C.The value of KC for the reaction

Which of the following reacts with ammoniacal cuprous chloride

The froth floatation process is used for the concentration of

Assertion (A) : A catalyst increases the rate of a reaction.Reason (R) : In presence of a catalyst, the activation energy of the reaction increases. The correct answer is

The reagent used in the preparation of aspirin from salicylic acid is

One mole of fluorine is reacted with two moles of hot concentrated KOH. The products formed are KF, H2O and O2. The molar ratio of KF, H2O and O2 respectively is

In the reaction AlCl3+Cl-→AlCl4-, AlCl3 is

Which pair of oxyacids of phosphorous contain ‘P - H' bonds

Which of the following is correct

Which of the following does not participate in carbylamine reaction?

Number of coulombs of current required to convert completely 1 mole of MnO4-ions in acid medium to one mole of Mn2+ions electrolytically is

when acetaldehyde is heated with Fehling solution, a red precipitate is formed. Which of the following is that

Assertion (A) : K, Rb and Cs form superoxides.Reason (R) ;     The stability of the superoxides increase from 'K' to 'Cs' dueto decrease in lattice energy. The correct answer is

In 0.01 M solution,HCN is 0.01% ionized. Its dissociation constant is

The quantum number which explains the line spectra observed as doublets in case of hydrogen and alkali metals and doublets and triplets in case of alkaline earth metals is

Which of the following is not correct

Bhopal gas tragedy of 1984 was caused by

The hydrolysis constant Kh of a salt of NaOH and a weak acid (HX) If the Ka of the acid is Ka=2x10-6

The method of separation of enantiomers from racemic mixture is known as

For the reaction 2SO2(g)+O2(g)2SO3(g) taking place in one litre vessel, the number of moles of SO2 ,O2,SO3 at equilibrium are 2,1 and 2 moles respectively, under a total pressure of 15 atm.The Kp of the reaction is

Zn(s)+Cu+2(ag)→Cu(s)+Zn+2(ag)Given that ΔfG0 for Cu+2(ag) and Zn+2(ag) are +65.0 K.J.mol-1 and -147.2 K.J.mol-1 respectively then the standard Gibbs energy change for the above reaction is

The magnetic oxide of iron is

For a reaction A+B→ products,the rate of the reaction was doubled.When the concentration of A was doubled.When the concentration of A and B were doubled.The order of the reaction with respect to A and B are

When compound X is oxidised by acidified potassium dichromate, compound Y is formed. Compound Y on reduction with LiAlH4 gives X. X and Y respectively are :

Calculate the hydrolysis constant of a salt of a weak acid(Ka=2x10-6) and of a weak base(Kb=5x10-7)

Which of the following statements is not correct ?

The oxidation states of nitrogen in NH4NO3 is /are

The rate of the reaction at 400C is 5 units.The rate of same reaction at 800C is nearly(temperature coefficient)